C26H25ClN2O3 — CID 29204639
3-chloro-N-[(2R)-2-(4-ethoxy-3-methoxyphenyl)-2-(1H-indol-3-yl)ethyl]benzamide (PubChem CID 29204639) has the molecular formula C26H25ClN2O3 and a molecular weight of 448.95 g/mol. Its IUPAC name is 3-chloro-N-[(2R)-2-(4-ethoxy-3-methoxyphenyl)-2-(1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 3-chloro-N-[(2R)-2-(4-ethoxy-3-methoxyphenyl)-2-(1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 29204639 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 3-chloro-N-[(2R)-2-(4-ethoxy-3-methoxyphenyl)-2-(1H-indol-3-yl)ethyl]benzamide |
| SMILES | CCOc1ccc([C@@H](CNC(=O)c2cccc(Cl)c2)c2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C26H25ClN2O3/c1-3-32-24-12-11-17(14-25(24)31-2)21(22-16-28-23-10-5-4-9-20(22)23)15-29-26(30)18-7-6-8-19(27)13-18/h4-14,16,21,28H,3,15H2,1-2H3,(H,29,30)/t21-/m1/s1 |
| InChIKey | QNHJUKRXAAZLSN-OAQYLSRUSA-N |
| XLogP | 5.79 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |