C27H27N3O5 — CID 46354806
methyl 2-[[2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]carbamoylamino]benzoate (PubChem CID 46354806) has the molecular formula C27H27N3O5 and a molecular weight of 473.53 g/mol. Its IUPAC name is methyl 2-[[2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]carbamoylamino]benzoate.
| Compound Name | methyl 2-[[2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 46354806 |
| Molecular Formula | C27H27N3O5 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | methyl 2-[[2-(3,4-dimethoxyphenyl)-2-(1H-indol-3-yl)ethyl]carbamoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)NCC(c1ccc(OC)c(OC)c1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H27N3O5/c1-33-24-13-12-17(14-25(24)34-2)20(21-16-28-22-10-6-4-8-18(21)22)15-29-27(32)30-23-11-7-5-9-19(23)26(31)35-3/h4-14,16,20,28H,15H2,1-3H3,(H2,29,30,32) |
| InChIKey | UGMFVNFYBMRRFG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 101.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |