C24H24N4O3 — CID 50801474
1-(2,5-dimethoxyphenyl)-3-[2-(1H-indol-3-yl)-2-pyridin-3-ylethyl]urea (PubChem CID 50801474) has the molecular formula C24H24N4O3 and a molecular weight of 416.48 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-[2-(1H-indol-3-yl)-2-pyridin-3-ylethyl]urea.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-[2-(1H-indol-3-yl)-2-pyridin-3-ylethyl]urea |
|---|---|
| PubChem CID | 50801474 |
| Molecular Formula | C24H24N4O3 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-[2-(1H-indol-3-yl)-2-pyridin-3-ylethyl]urea |
| SMILES | COc1ccc(OC)c(NC(=O)NCC(c2cccnc2)c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C24H24N4O3/c1-30-17-9-10-23(31-2)22(12-17)28-24(29)27-14-19(16-6-5-11-25-13-16)20-15-26-21-8-4-3-7-18(20)21/h3-13,15,19,26H,14H2,1-2H3,(H2,27,28,29) |
| InChIKey | RSDMSVKDLPDGTL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |