C25H26N4O4 — CID 92875917
1-[(2R)-2-(1H-indol-3-yl)-2-pyridin-3-ylethyl]-3-(3,4,5-trimethoxyphenyl)urea (PubChem CID 92875917) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 1-[(2R)-2-(1H-indol-3-yl)-2-pyridin-3-ylethyl]-3-(3,4,5-trimethoxyphenyl)urea.
| Compound Name | 1-[(2R)-2-(1H-indol-3-yl)-2-pyridin-3-ylethyl]-3-(3,4,5-trimethoxyphenyl)urea |
|---|---|
| PubChem CID | 92875917 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 1-[(2R)-2-(1H-indol-3-yl)-2-pyridin-3-ylethyl]-3-(3,4,5-trimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)NC[C@H](c2cccnc2)c2c[nH]c3ccccc23)cc(OC)c1OC |
| InChI | InChI=1S/C25H26N4O4/c1-31-22-11-17(12-23(32-2)24(22)33-3)29-25(30)28-14-19(16-7-6-10-26-13-16)20-15-27-21-9-5-4-8-18(20)21/h4-13,15,19,27H,14H2,1-3H3,(H2,28,29,30)/t19-/m1/s1 |
| InChIKey | GWZLRKFYXNEMHJ-LJQANCHMSA-N |
| XLogP | 4.54 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |