C25H24FN3O3 — CID 92892882
1-(3,4-dimethoxyphenyl)-3-[(2R)-2-(4-fluorophenyl)-2-(1H-indol-3-yl)ethyl]urea (PubChem CID 92892882) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[(2R)-2-(4-fluorophenyl)-2-(1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[(2R)-2-(4-fluorophenyl)-2-(1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 92892882 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[(2R)-2-(4-fluorophenyl)-2-(1H-indol-3-yl)ethyl]urea |
| SMILES | COc1ccc(NC(=O)NC[C@H](c2ccc(F)cc2)c2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C25H24FN3O3/c1-31-23-12-11-18(13-24(23)32-2)29-25(30)28-14-20(16-7-9-17(26)10-8-16)21-15-27-22-6-4-3-5-19(21)22/h3-13,15,20,27H,14H2,1-2H3,(H2,28,29,30)/t20-/m1/s1 |
| InChIKey | AXWIUHJCLCFCHE-HXUWFJFHSA-N |
| XLogP | 5.28 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |