C27H26N4O2S — CID 172694399
1-[2,2-bis(1H-indol-3-yl)ethyl]-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 172694399) has the molecular formula C27H26N4O2S and a molecular weight of 470.60 g/mol. Its IUPAC name is 1-[2,2-bis(1H-indol-3-yl)ethyl]-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[2,2-bis(1H-indol-3-yl)ethyl]-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 172694399 |
| Molecular Formula | C27H26N4O2S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 1-[2,2-bis(1H-indol-3-yl)ethyl]-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCC(c2c[nH]c3ccccc23)c2c[nH]c3ccccc23)cc1OC |
| InChI | InChI=1S/C27H26N4O2S/c1-32-25-12-11-17(13-26(25)33-2)31-27(34)30-16-22(20-14-28-23-9-5-3-7-18(20)23)21-15-29-24-10-6-4-8-19(21)24/h3-15,22,28-29H,16H2,1-2H3,(H2,30,31,34) |
| InChIKey | CCXBJAZNBSAMOL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 74.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|