C20H26N2O2S — CID 100704521
1-[(2S)-2-benzylbutyl]-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 100704521) has the molecular formula C20H26N2O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 1-[(2S)-2-benzylbutyl]-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[(2S)-2-benzylbutyl]-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100704521 |
| Molecular Formula | C20H26N2O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 1-[(2S)-2-benzylbutyl]-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | CC[C@H](CNC(=S)Nc1ccc(OC)c(OC)c1)Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2O2S/c1-4-15(12-16-8-6-5-7-9-16)14-21-20(25)22-17-10-11-18(23-2)19(13-17)24-3/h5-11,13,15H,4,12,14H2,1-3H3,(H2,21,22,25)/t15-/m0/s1 |
| InChIKey | VCOADALKSCUJCK-HNNXBMFYSA-N |
| XLogP | 4.26 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|