C19H24N2O2S2 — CID 100691949
1-(3-benzylsulfanylpropyl)-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 100691949) has the molecular formula C19H24N2O2S2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 1-(3-benzylsulfanylpropyl)-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-(3-benzylsulfanylpropyl)-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100691949 |
| Molecular Formula | C19H24N2O2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 1-(3-benzylsulfanylpropyl)-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCCSCc2ccccc2)cc1OC |
| InChI | InChI=1S/C19H24N2O2S2/c1-22-17-10-9-16(13-18(17)23-2)21-19(24)20-11-6-12-25-14-15-7-4-3-5-8-15/h3-5,7-10,13H,6,11-12,14H2,1-2H3,(H2,20,21,24) |
| InChIKey | KJTULJWNDSPYRC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|