C19H23FN2O2S2 — CID 100697573
1-(3,4-dimethoxyphenyl)-3-[3-[(2-fluorophenyl)methylsulfanyl]propyl]thiourea (PubChem CID 100697573) has the molecular formula C19H23FN2O2S2 and a molecular weight of 394.54 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[3-[(2-fluorophenyl)methylsulfanyl]propyl]thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[3-[(2-fluorophenyl)methylsulfanyl]propyl]thiourea |
|---|---|
| PubChem CID | 100697573 |
| Molecular Formula | C19H23FN2O2S2 |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[3-[(2-fluorophenyl)methylsulfanyl]propyl]thiourea |
| SMILES | COc1ccc(NC(=S)NCCCSCc2ccccc2F)cc1OC |
| InChI | InChI=1S/C19H23FN2O2S2/c1-23-17-9-8-15(12-18(17)24-2)22-19(25)21-10-5-11-26-13-14-6-3-4-7-16(14)20/h3-4,6-9,12H,5,10-11,13H2,1-2H3,(H2,21,22,25) |
| InChIKey | PPOPHYJWDLALPU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|