C18H19FN2O2S2 — CID 100622131
methyl 3-[2-[(2-fluorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate (PubChem CID 100622131) has the molecular formula C18H19FN2O2S2 and a molecular weight of 378.49 g/mol. Its IUPAC name is methyl 3-[2-[(2-fluorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate.
| Compound Name | methyl 3-[2-[(2-fluorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100622131 |
| Molecular Formula | C18H19FN2O2S2 |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | methyl 3-[2-[(2-fluorophenyl)methylsulfanyl]ethylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=S)NCCSCc2ccccc2F)c1 |
| InChI | InChI=1S/C18H19FN2O2S2/c1-23-17(22)13-6-4-7-15(11-13)21-18(24)20-9-10-25-12-14-5-2-3-8-16(14)19/h2-8,11H,9-10,12H2,1H3,(H2,20,21,24) |
| InChIKey | SXYUIXREYFSUJB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|