C19H20ClFN2O2S2 — CID 100697885
methyl 2-chloro-5-[3-[(2-fluorophenyl)methylsulfanyl]propylcarbamothioylamino]benzoate (PubChem CID 100697885) has the molecular formula C19H20ClFN2O2S2 and a molecular weight of 426.97 g/mol. Its IUPAC name is methyl 2-chloro-5-[3-[(2-fluorophenyl)methylsulfanyl]propylcarbamothioylamino]benzoate.
| Compound Name | methyl 2-chloro-5-[3-[(2-fluorophenyl)methylsulfanyl]propylcarbamothioylamino]benzoate |
|---|---|
| PubChem CID | 100697885 |
| Molecular Formula | C19H20ClFN2O2S2 |
| Molecular Weight | 426.97 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | methyl 2-chloro-5-[3-[(2-fluorophenyl)methylsulfanyl]propylcarbamothioylamino]benzoate |
| SMILES | COC(=O)c1cc(NC(=S)NCCCSCc2ccccc2F)ccc1Cl |
| InChI | InChI=1S/C19H20ClFN2O2S2/c1-25-18(24)15-11-14(7-8-16(15)20)23-19(26)22-9-4-10-27-12-13-5-2-3-6-17(13)21/h2-3,5-8,11H,4,9-10,12H2,1H3,(H2,22,23,26) |
| InChIKey | VDNUTSLCCCASEP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.97 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|