C17H17ClF2N2S2 — CID 100698848
1-(3-chloro-4-fluorophenyl)-3-[3-[(4-fluorophenyl)methylsulfanyl]propyl]thiourea (PubChem CID 100698848) has the molecular formula C17H17ClF2N2S2 and a molecular weight of 386.92 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[3-[(4-fluorophenyl)methylsulfanyl]propyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[3-[(4-fluorophenyl)methylsulfanyl]propyl]thiourea |
|---|---|
| PubChem CID | 100698848 |
| Molecular Formula | C17H17ClF2N2S2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[3-[(4-fluorophenyl)methylsulfanyl]propyl]thiourea |
| SMILES | Fc1ccc(CSCCCNC(=S)Nc2ccc(F)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17ClF2N2S2/c18-15-10-14(6-7-16(15)20)22-17(23)21-8-1-9-24-11-12-2-4-13(19)5-3-12/h2-7,10H,1,8-9,11H2,(H2,21,22,23) |
| InChIKey | LNBKVZRCHITLEV-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|