C17H18Cl2N2S2 — CID 100696342
1-(2-chlorophenyl)-3-[3-[(4-chlorophenyl)methylsulfanyl]propyl]thiourea (PubChem CID 100696342) has the molecular formula C17H18Cl2N2S2 and a molecular weight of 385.39 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-3-[3-[(4-chlorophenyl)methylsulfanyl]propyl]thiourea.
| Compound Name | 1-(2-chlorophenyl)-3-[3-[(4-chlorophenyl)methylsulfanyl]propyl]thiourea |
|---|---|
| PubChem CID | 100696342 |
| Molecular Formula | C17H18Cl2N2S2 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 384.03 |
| IUPAC Name | 1-(2-chlorophenyl)-3-[3-[(4-chlorophenyl)methylsulfanyl]propyl]thiourea |
| SMILES | S=C(NCCCSCc1ccc(Cl)cc1)Nc1ccccc1Cl |
| InChI | InChI=1S/C17H18Cl2N2S2/c18-14-8-6-13(7-9-14)12-23-11-3-10-20-17(22)21-16-5-2-1-4-15(16)19/h1-2,4-9H,3,10-12H2,(H2,20,21,22) |
| InChIKey | XVURTJMGGOINPU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|