C17H20ClN3OS2 — CID 100697250
1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(6-methoxy-3-pyridinyl)thiourea (PubChem CID 100697250) has the molecular formula C17H20ClN3OS2 and a molecular weight of 381.95 g/mol. Its IUPAC name is 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(6-methoxy-3-pyridinyl)thiourea.
| Compound Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(6-methoxy-3-pyridinyl)thiourea |
|---|---|
| PubChem CID | 100697250 |
| Molecular Formula | C17H20ClN3OS2 |
| Molecular Weight | 381.95 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(6-methoxy-3-pyridinyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCCSCc2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C17H20ClN3OS2/c1-22-16-8-7-15(11-20-16)21-17(23)19-9-2-10-24-12-13-3-5-14(18)6-4-13/h3-8,11H,2,9-10,12H2,1H3,(H2,19,21,23) |
| InChIKey | PVLMNVPLBQJYOR-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.95 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|