C20H23ClN2OS2 — CID 100697010
1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-prop-2-enoxyphenyl)thiourea (PubChem CID 100697010) has the molecular formula C20H23ClN2OS2 and a molecular weight of 407.00 g/mol. Its IUPAC name is 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100697010 |
| Molecular Formula | C20H23ClN2OS2 |
| Molecular Weight | 407.00 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 1-[3-[(4-chlorophenyl)methylsulfanyl]propyl]-3-(4-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1ccc(NC(=S)NCCCSCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H23ClN2OS2/c1-2-13-24-19-10-8-18(9-11-19)23-20(25)22-12-3-14-26-15-16-4-6-17(21)7-5-16/h2,4-11H,1,3,12-15H2,(H2,22,23,25) |
| InChIKey | ARVJOWSCDURHOH-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.00 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|