C18H26N2OS2 — CID 100603032
1-(2-cyclohexylsulfanylethyl)-3-(4-prop-2-enoxyphenyl)thiourea (PubChem CID 100603032) has the molecular formula C18H26N2OS2 and a molecular weight of 350.55 g/mol. Its IUPAC name is 1-(2-cyclohexylsulfanylethyl)-3-(4-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-(2-cyclohexylsulfanylethyl)-3-(4-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100603032 |
| Molecular Formula | C18H26N2OS2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-(2-cyclohexylsulfanylethyl)-3-(4-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1ccc(NC(=S)NCCSC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2OS2/c1-2-13-21-16-10-8-15(9-11-16)20-18(22)19-12-14-23-17-6-4-3-5-7-17/h2,8-11,17H,1,3-7,12-14H2,(H2,19,20,22) |
| InChIKey | JUHQRIWAWOEYJZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|