C13H18N2O2S — CID 100584082
1-(2-methoxyethyl)-3-(4-prop-2-enoxyphenyl)thiourea (PubChem CID 100584082) has the molecular formula C13H18N2O2S and a molecular weight of 266.37 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-3-(4-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-(2-methoxyethyl)-3-(4-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100584082 |
| Molecular Formula | C13H18N2O2S |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(2-methoxyethyl)-3-(4-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1ccc(NC(=S)NCCOC)cc1 |
| InChI | InChI=1S/C13H18N2O2S/c1-3-9-17-12-6-4-11(5-7-12)15-13(18)14-8-10-16-2/h3-7H,1,8-10H2,2H3,(H2,14,15,18) |
| InChIKey | KLLZJASHWRPGHA-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|