C20H31N3OS — CID 100737512
1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(4-prop-2-enoxyphenyl)thiourea (PubChem CID 100737512) has the molecular formula C20H31N3OS and a molecular weight of 361.56 g/mol. Its IUPAC name is 1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(4-prop-2-enoxyphenyl)thiourea.
| Compound Name | 1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(4-prop-2-enoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100737512 |
| Molecular Formula | C20H31N3OS |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-(4-prop-2-enoxyphenyl)thiourea |
| SMILES | C=CCOc1ccc(NC(=S)NCCCN2C[C@H](C)C[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C20H31N3OS/c1-4-12-24-19-8-6-18(7-9-19)22-20(25)21-10-5-11-23-14-16(2)13-17(3)15-23/h4,6-9,16-17H,1,5,10-15H2,2-3H3,(H2,21,22,25)/t16-,17-/m1/s1 |
| InChIKey | LFNUWRUZYGZFMJ-IAGOWNOFSA-N |
| XLogP | 3.91 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|