C19H31N3O2S — CID 100736521
1-(3,4-dimethoxyphenyl)-3-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]thiourea (PubChem CID 100736521) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]thiourea |
|---|---|
| PubChem CID | 100736521 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[3-[(3R,5S)-3,5-dimethylpiperidin-1-yl]propyl]thiourea |
| SMILES | COc1ccc(NC(=S)NCCCN2C[C@H](C)C[C@H](C)C2)cc1OC |
| InChI | InChI=1S/C19H31N3O2S/c1-14-10-15(2)13-22(12-14)9-5-8-20-19(25)21-16-6-7-17(23-3)18(11-16)24-4/h6-7,11,14-15H,5,8-10,12-13H2,1-4H3,(H2,20,21,25)/t14-,15+ |
| InChIKey | OTLZASMVNSZFEP-GASCZTMLSA-N |
| XLogP | 3.36 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|