C18H26F3N3S — CID 100736490
1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 100736490) has the molecular formula C18H26F3N3S and a molecular weight of 373.49 g/mol. Its IUPAC name is 1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 100736490 |
| Molecular Formula | C18H26F3N3S |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=S)Nc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C18H26F3N3S/c1-13-9-14(2)12-24(11-13)8-4-7-22-17(25)23-16-6-3-5-15(10-16)18(19,20)21/h3,5-6,10,13-14H,4,7-9,11-12H2,1-2H3,(H2,22,23,25)/t13-,14-/m1/s1 |
| InChIKey | OOIKLAGQEALCPD-ZIAGYGMSSA-N |
| XLogP | 4.36 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|