C17H25BrFN3S — CID 133154863
1-(4-bromo-2-fluorophenyl)-3-[3-(3,5-dimethylpiperidin-1-yl)propyl]thiourea (PubChem CID 133154863) has the molecular formula C17H25BrFN3S and a molecular weight of 402.38 g/mol. Its IUPAC name is 1-(4-bromo-2-fluorophenyl)-3-[3-(3,5-dimethylpiperidin-1-yl)propyl]thiourea.
| Compound Name | 1-(4-bromo-2-fluorophenyl)-3-[3-(3,5-dimethylpiperidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 133154863 |
| Molecular Formula | C17H25BrFN3S |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 1-(4-bromo-2-fluorophenyl)-3-[3-(3,5-dimethylpiperidin-1-yl)propyl]thiourea |
| SMILES | CC1CC(C)CN(CCCNC(=S)Nc2ccc(Br)cc2F)C1 |
| InChI | InChI=1S/C17H25BrFN3S/c1-12-8-13(2)11-22(10-12)7-3-6-20-17(23)21-16-5-4-14(18)9-15(16)19/h4-5,9,12-13H,3,6-8,10-11H2,1-2H3,(H2,20,21,23) |
| InChIKey | QUWBDHHIBJLCQQ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|