C13H13BrF2N4S — CID 2206354
1-[3-(4-bromopyrazol-1-yl)propyl]-3-(2,4-difluorophenyl)thiourea (PubChem CID 2206354) has the molecular formula C13H13BrF2N4S and a molecular weight of 375.24 g/mol. Its IUPAC name is 1-[3-(4-bromopyrazol-1-yl)propyl]-3-(2,4-difluorophenyl)thiourea.
| Compound Name | 1-[3-(4-bromopyrazol-1-yl)propyl]-3-(2,4-difluorophenyl)thiourea |
|---|---|
| PubChem CID | 2206354 |
| Molecular Formula | C13H13BrF2N4S |
| Molecular Weight | 375.24 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | 1-[3-(4-bromopyrazol-1-yl)propyl]-3-(2,4-difluorophenyl)thiourea |
| SMILES | Fc1ccc(NC(=S)NCCCn2cc(Br)cn2)c(F)c1 |
| InChI | InChI=1S/C13H13BrF2N4S/c14-9-7-18-20(8-9)5-1-4-17-13(21)19-12-3-2-10(15)6-11(12)16/h2-3,6-8H,1,4-5H2,(H2,17,19,21) |
| InChIKey | IZEQVDLRIGFFRI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.24 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|