C15H22F2N2S — CID 19651018
1-(2,4-difluorophenyl)-3-octylthiourea (PubChem CID 19651018) has the molecular formula C15H22F2N2S and a molecular weight of 300.42 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-octylthiourea.
| Compound Name | 1-(2,4-difluorophenyl)-3-octylthiourea |
|---|---|
| PubChem CID | 19651018 |
| Molecular Formula | C15H22F2N2S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-octylthiourea |
| SMILES | CCCCCCCCNC(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H22F2N2S/c1-2-3-4-5-6-7-10-18-15(20)19-14-9-8-12(16)11-13(14)17/h8-9,11H,2-7,10H2,1H3,(H2,18,19,20) |
| InChIKey | BUOPTACVGMKONN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|