C10H12BrFN2S — CID 115583541
1-(2-bromo-4-fluorophenyl)-3-propylthiourea (PubChem CID 115583541) has the molecular formula C10H12BrFN2S and a molecular weight of 291.19 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-3-propylthiourea.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-3-propylthiourea |
|---|---|
| PubChem CID | 115583541 |
| Molecular Formula | C10H12BrFN2S |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-3-propylthiourea |
| SMILES | CCCNC(=S)Nc1ccc(F)cc1Br |
| InChI | InChI=1S/C10H12BrFN2S/c1-2-5-13-10(15)14-9-4-3-7(12)6-8(9)11/h3-4,6H,2,5H2,1H3,(H2,13,14,15) |
| InChIKey | LFEXTBOYUSQOSB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|