C14H14BrFN2OS2 — CID 3713412
1-(2-bromo-4-fluorophenyl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea (PubChem CID 3713412) has the molecular formula C14H14BrFN2OS2 and a molecular weight of 389.32 g/mol. Its IUPAC name is 1-(2-bromo-4-fluorophenyl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea.
| Compound Name | 1-(2-bromo-4-fluorophenyl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea |
|---|---|
| PubChem CID | 3713412 |
| Molecular Formula | C14H14BrFN2OS2 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 1-(2-bromo-4-fluorophenyl)-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea |
| SMILES | Fc1ccc(NC(=S)NCCSCc2ccco2)c(Br)c1 |
| InChI | InChI=1S/C14H14BrFN2OS2/c15-12-8-10(16)3-4-13(12)18-14(20)17-5-7-21-9-11-2-1-6-19-11/h1-4,6,8H,5,7,9H2,(H2,17,18,20) |
| InChIKey | HJKYBMKTAOFRRH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|