C10H16N2OS2 — CID 8769278
1-ethyl-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea (PubChem CID 8769278) has the molecular formula C10H16N2OS2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-ethyl-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea.
| Compound Name | 1-ethyl-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea |
|---|---|
| PubChem CID | 8769278 |
| Molecular Formula | C10H16N2OS2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-ethyl-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea |
| SMILES | CCNC(=S)NCCSCc1ccco1 |
| InChI | InChI=1S/C10H16N2OS2/c1-2-11-10(14)12-5-7-15-8-9-4-3-6-13-9/h3-4,6H,2,5,7-8H2,1H3,(H2,11,12,14) |
| InChIKey | GPXRNOHDKJEMHB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|