C15H22N2OS2 — CID 11919337
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea (PubChem CID 11919337) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea |
|---|---|
| PubChem CID | 11919337 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(furan-2-ylmethylsulfanyl)ethyl]thiourea |
| SMILES | S=C(NCCSCc1ccco1)N[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C15H22N2OS2/c19-15(17-14-9-11-3-4-12(14)8-11)16-5-7-20-10-13-2-1-6-18-13/h1-2,6,11-12,14H,3-5,7-10H2,(H2,16,17,19)/t11-,12+,14+/m0/s1 |
| InChIKey | YFTLTNFONGJKFN-OUCADQQQSA-N |
| XLogP | 3.17 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|