C18H23N3S — CID 11919271
1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(1H-indol-3-yl)ethyl]thiourea (PubChem CID 11919271) has the molecular formula C18H23N3S and a molecular weight of 313.47 g/mol. Its IUPAC name is 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(1H-indol-3-yl)ethyl]thiourea.
| Compound Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(1H-indol-3-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 11919271 |
| Molecular Formula | C18H23N3S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-[(1R,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(1H-indol-3-yl)ethyl]thiourea |
| SMILES | S=C(NCCc1c[nH]c2ccccc12)N[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C18H23N3S/c22-18(21-17-10-12-5-6-13(17)9-12)19-8-7-14-11-20-16-4-2-1-3-15(14)16/h1-4,11-13,17,20H,5-10H2,(H2,19,21,22)/t12-,13+,17+/m0/s1 |
| InChIKey | YCFLUMKZNZVUQR-OGHNNQOOSA-N |
| XLogP | 3.36 |
| TPSA | 39.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|