C14H16N2S — CID 3005127
N-[2-(1H-indol-3-yl)ethyl]but-3-enethioamide (PubChem CID 3005127) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]but-3-enethioamide.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]but-3-enethioamide |
|---|---|
| PubChem CID | 3005127 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]but-3-enethioamide |
| SMILES | C=CCC(=S)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H16N2S/c1-2-5-14(17)15-9-8-11-10-16-13-7-4-3-6-12(11)13/h2-4,6-7,10,16H,1,5,8-9H2,(H,15,17) |
| InChIKey | IYVBEJWPJTUBIB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|