About 3-but-3-enyl-1H-indole
3-but-3-enyl-1H-indole (PubChem CID 57142098) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-but-3-enyl-1H-indole.
Molecular Properties
| Compound Name | 3-but-3-enyl-1H-indole |
| PubChem CID | 57142098 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | 3-but-3-enyl-1H-indole |
| SMILES | C=CCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H13N/c1-2-3-6-10-9-13-12-8-5-4-7-11(10)12/h2,4-5,7-9,13H,1,3,6H2 |
| InChIKey | HKDOJAIZVSWKNY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-but-3-enyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-but-3-enyl-1H-indole?
The IUPAC name of 3-but-3-enyl-1H-indole (CID 57142098) is 3-but-3-enyl-1H-indole.
What is the SMILES notation for 3-but-3-enyl-1H-indole?
The canonical SMILES for 3-but-3-enyl-1H-indole is C=CCCc1c[nH]c2ccccc12.
What is the InChIKey of 3-but-3-enyl-1H-indole?
The InChIKey is HKDOJAIZVSWKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13N/c1-2-3-6-10-9-13-12-8-5-4-7-11(10)12/h2,4-5,7-9,13H,1,3,6H2.
What are the key properties of 3-but-3-enyl-1H-indole?
3-but-3-enyl-1H-indole has a molecular weight of 171.24 g/mol, XLogP of 3.29, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-but-3-enyl-1H-indole is sourced from PubChem (CID 57142098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).