C18H26N4 — CID 109496534
3-[2-(1H-indol-3-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine (PubChem CID 109496534) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine.
| Compound Name | 3-[2-(1H-indol-3-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109496534 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 3-[2-(1H-indol-3-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H26N4/c1-4-5-8-13-22(3)18(19-2)20-12-11-15-14-21-17-10-7-6-9-16(15)17/h4,6-7,9-10,14,21H,1,5,8,11-13H2,2-3H3,(H,19,20) |
| InChIKey | MWWNYGKHLAYHJO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|