C18H27IN4 — CID 109496349
3-[2-(1H-indol-2-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109496349) has the molecular formula C18H27IN4 and a molecular weight of 426.35 g/mol. Its IUPAC name is 3-[2-(1H-indol-2-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-[2-(1H-indol-2-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109496349 |
| Molecular Formula | C18H27IN4 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-[2-(1H-indol-2-yl)ethyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCCc1cc2ccccc2[nH]1.I |
| InChI | InChI=1S/C18H26N4.HI/c1-4-5-8-13-22(3)18(19-2)20-12-11-16-14-15-9-6-7-10-17(15)21-16;/h4,6-7,9-10,14,21H,1,5,8,11-13H2,2-3H3,(H,19,20);1H |
| InChIKey | UYVXJBSOULARLW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|