C19H30IN5 — CID 109483900
3-[2-(1H-benzimidazol-2-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide (PubChem CID 109483900) has the molecular formula C19H30IN5 and a molecular weight of 455.39 g/mol. Its IUPAC name is 3-[2-(1H-benzimidazol-2-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide.
| Compound Name | 3-[2-(1H-benzimidazol-2-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109483900 |
| Molecular Formula | C19H30IN5 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | 3-[2-(1H-benzimidazol-2-yl)ethyl]-1-hept-6-enyl-1,2-dimethylguanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCc1nc2ccccc2[nH]1.I |
| InChI | InChI=1S/C19H29N5.HI/c1-4-5-6-7-10-15-24(3)19(20-2)21-14-13-18-22-16-11-8-9-12-17(16)23-18;/h4,8-9,11-12H,1,5-7,10,13-15H2,2-3H3,(H,20,21)(H,22,23);1H |
| InChIKey | JMFVCHWWOIVMDA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|