C18H28N6O — CID 109483767
3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-1-hept-6-enyl-1,2-dimethylguanidine (PubChem CID 109483767) has the molecular formula C18H28N6O and a molecular weight of 344.46 g/mol. Its IUPAC name is 3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-1-hept-6-enyl-1,2-dimethylguanidine.
| Compound Name | 3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-1-hept-6-enyl-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 109483767 |
| Molecular Formula | C18H28N6O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.23 |
| IUPAC Name | 3-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]-1-hept-6-enyl-1,2-dimethylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N\C)NCCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C18H28N6O/c1-4-5-6-7-8-13-24(3)18(19-2)20-12-11-16-21-17(23-22-16)15-10-9-14-25-15/h4,9-10,14H,1,5-8,11-13H2,2-3H3,(H,19,20)(H,21,22,23) |
| InChIKey | GNZYVNVKPRERSW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|