C10H11ClN4O2 — CID 166403893
2-chloro-N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]acetamide (PubChem CID 166403893) has the molecular formula C10H11ClN4O2 and a molecular weight of 254.68 g/mol. Its IUPAC name is 2-chloro-N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]acetamide.
| Compound Name | 2-chloro-N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 166403893 |
| Molecular Formula | C10H11ClN4O2 |
| Molecular Weight | 254.68 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 2-chloro-N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]acetamide |
| SMILES | O=C(CCl)NCCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C10H11ClN4O2/c11-6-9(16)12-4-3-8-13-10(15-14-8)7-2-1-5-17-7/h1-2,5H,3-4,6H2,(H,12,16)(H,13,14,15) |
| InChIKey | SJXVBTRLEPMQCU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.68 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|