C7H6ClN3O — CID 79600359
5-(chloromethyl)-3-(furan-2-yl)-1H-1,2,4-triazole (PubChem CID 79600359) has the molecular formula C7H6ClN3O and a molecular weight of 183.60 g/mol. Its IUPAC name is 5-(chloromethyl)-3-(furan-2-yl)-1H-1,2,4-triazole.
| Compound Name | 5-(chloromethyl)-3-(furan-2-yl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 79600359 |
| Molecular Formula | C7H6ClN3O |
| Molecular Weight | 183.60 g/mol |
| Exact Mass | 183.02 |
| IUPAC Name | 5-(chloromethyl)-3-(furan-2-yl)-1H-1,2,4-triazole |
| SMILES | ClCc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C7H6ClN3O/c8-4-6-9-7(11-10-6)5-2-1-3-12-5/h1-3H,4H2,(H,9,10,11) |
| InChIKey | QGQAEQHHEIZCPS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.60 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|