C10H11N3O3 — CID 18801946
ethyl 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]acetate (PubChem CID 18801946) has the molecular formula C10H11N3O3 and a molecular weight of 221.22 g/mol. Its IUPAC name is ethyl 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]acetate.
| Compound Name | ethyl 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]acetate |
|---|---|
| PubChem CID | 18801946 |
| Molecular Formula | C10H11N3O3 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | ethyl 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C10H11N3O3/c1-2-15-9(14)6-8-11-10(13-12-8)7-4-3-5-16-7/h3-5H,2,6H2,1H3,(H,11,12,13) |
| InChIKey | IWWOVJIXHRVWBM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |