About 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine
2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine (PubChem CID 90741695) has the molecular formula C8H8N4O
and a molecular weight of 176.18 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine.
Molecular Properties
| Compound Name | 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine |
| PubChem CID | 90741695 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine |
| SMILES | [H]/N=C/Cc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C8H8N4O/c9-4-3-7-10-8(12-11-7)6-2-1-5-13-6/h1-2,4-5,9H,3H2,(H,10,11,12)/b9-4+ |
| InChIKey | CVLKTSQEBGBSRZ-RUDMXATFSA-N |
| XLogP | 1.26 |
| TPSA | 78.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine?
The IUPAC name of 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine (CID 90741695) is 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine.
What is the SMILES notation for 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine?
The canonical SMILES for 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine is [H]/N=C/Cc1nc(-c2ccco2)n[nH]1.
What is the InChIKey of 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine?
The InChIKey is CVLKTSQEBGBSRZ-RUDMXATFSA-N. The full InChI is InChI=1S/C8H8N4O/c9-4-3-7-10-8(12-11-7)6-2-1-5-13-6/h1-2,4-5,9H,3H2,(H,10,11,12)/b9-4+.
What are the key properties of 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine?
2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine has a molecular weight of 176.18 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine is sourced from PubChem (CID 90741695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).