C8H8N4O — CID 90741695
2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine (PubChem CID 90741695) has the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. Its IUPAC name is 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine.
| Compound Name | 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine |
|---|---|
| PubChem CID | 90741695 |
| Molecular Formula | C8H8N4O |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethanimine |
| SMILES | [H]/N=C/Cc1nc(-c2ccco2)n[nH]1 |
| InChI | InChI=1S/C8H8N4O/c9-4-3-7-10-8(12-11-7)6-2-1-5-13-6/h1-2,4-5,9H,3H2,(H,10,11,12)/b9-4+ |
| InChIKey | CVLKTSQEBGBSRZ-RUDMXATFSA-N |
| XLogP | 1.26 |
| TPSA | 78.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|