C14H9F5N4O3S — CID 167893550
2,3,4,5,6-pentafluoro-N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]benzenesulfonamide (PubChem CID 167893550) has the molecular formula C14H9F5N4O3S and a molecular weight of 408.31 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluoro-N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]benzenesulfonamide.
| Compound Name | 2,3,4,5,6-pentafluoro-N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 167893550 |
| Molecular Formula | C14H9F5N4O3S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 2,3,4,5,6-pentafluoro-N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCCc1nc(-c2ccco2)n[nH]1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H9F5N4O3S/c15-8-9(16)11(18)13(12(19)10(8)17)27(24,25)20-4-3-7-21-14(23-22-7)6-2-1-5-26-6/h1-2,5,20H,3-4H2,(H,21,22,23) |
| InChIKey | LQRSCPHAJDNVCO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|