C19H24N4O2 — CID 75364800
N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]adamantane-2-carboxamide (PubChem CID 75364800) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]adamantane-2-carboxamide.
| Compound Name | N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]adamantane-2-carboxamide |
|---|---|
| PubChem CID | 75364800 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | N-[2-[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]ethyl]adamantane-2-carboxamide |
| SMILES | O=C(NCCc1nc(-c2ccco2)n[nH]1)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H24N4O2/c24-19(17-13-7-11-6-12(9-13)10-14(17)8-11)20-4-3-16-21-18(23-22-16)15-2-1-5-25-15/h1-2,5,11-14,17H,3-4,6-10H2,(H,20,24)(H,21,22,23) |
| InChIKey | KZUWZXDMLWQENN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |