C19H21N3O2 — CID 24948913
1-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-7-phenylheptan-1-one (PubChem CID 24948913) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-7-phenylheptan-1-one.
| Compound Name | 1-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-7-phenylheptan-1-one |
|---|---|
| PubChem CID | 24948913 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-[5-(furan-2-yl)-1H-1,2,4-triazol-3-yl]-7-phenylheptan-1-one |
| SMILES | O=C(CCCCCCc1ccccc1)c1n[nH]c(-c2ccco2)n1 |
| InChI | InChI=1S/C19H21N3O2/c23-16(18-20-19(22-21-18)17-13-8-14-24-17)12-7-2-1-4-9-15-10-5-3-6-11-15/h3,5-6,8,10-11,13-14H,1-2,4,7,9,12H2,(H,20,21,22) |
| InChIKey | FBFRVQHDJXCILD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|