C15H23IN6O — CID 109499185
3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109499185) has the molecular formula C15H23IN6O and a molecular weight of 430.29 g/mol. Its IUPAC name is 3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109499185 |
| Molecular Formula | C15H23IN6O |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-[[3-(furan-2-yl)-1H-1,2,4-triazol-5-yl]methyl]-1,2-dimethyl-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1nc(-c2ccco2)n[nH]1.I |
| InChI | InChI=1S/C15H22N6O.HI/c1-4-5-6-9-21(3)15(16-2)17-11-13-18-14(20-19-13)12-8-7-10-22-12;/h4,7-8,10H,1,5-6,9,11H2,2-3H3,(H,16,17)(H,18,19,20);1H |
| InChIKey | VTNXVVDENGEPPS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|