C13H20F3IN4S — CID 109496813
1,2-dimethyl-1-pent-4-enyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 109496813) has the molecular formula C13H20F3IN4S and a molecular weight of 448.30 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109496813 |
| Molecular Formula | C13H20F3IN4S |
| Molecular Weight | 448.30 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C13H19F3N4S.HI/c1-4-5-6-7-20(3)12(17-2)18-8-11-19-10(9-21-11)13(14,15)16;/h4,9H,1,5-8H2,2-3H3,(H,17,18);1H |
| InChIKey | NBMHPMAAOFZHBB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 40.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.30 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|