C14H22F3N5 — CID 109496346
1,2-dimethyl-3-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-pent-4-enylguanidine (PubChem CID 109496346) has the molecular formula C14H22F3N5 and a molecular weight of 317.36 g/mol. Its IUPAC name is 1,2-dimethyl-3-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-pent-4-enylguanidine.
| Compound Name | 1,2-dimethyl-3-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109496346 |
| Molecular Formula | C14H22F3N5 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 1,2-dimethyl-3-[[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]methyl]-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1cn(C)nc1C(F)(F)F |
| InChI | InChI=1S/C14H22F3N5/c1-5-6-7-8-21(3)13(18-2)19-9-11-10-22(4)20-12(11)14(15,16)17/h5,10H,1,6-9H2,2-4H3,(H,18,19) |
| InChIKey | NASDMFAUIHKBER-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|