C15H28IN5 — CID 109499171
1,2-dimethyl-1-pent-4-enyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 109499171) has the molecular formula C15H28IN5 and a molecular weight of 405.33 g/mol. Its IUPAC name is 1,2-dimethyl-1-pent-4-enyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-pent-4-enyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109499171 |
| Molecular Formula | C15H28IN5 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 1,2-dimethyl-1-pent-4-enyl-3-[(1,3,5-trimethylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N\C)NCc1c(C)nn(C)c1C.I |
| InChI | InChI=1S/C15H27N5.HI/c1-7-8-9-10-19(5)15(16-4)17-11-14-12(2)18-20(6)13(14)3;/h7H,1,8-11H2,2-6H3,(H,16,17);1H |
| InChIKey | DVRSKCRZAPPVGJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|