C17H31N5 — CID 109498152
3-ethyl-1-methyl-1-pent-4-enyl-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine (PubChem CID 109498152) has the molecular formula C17H31N5 and a molecular weight of 305.47 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-pent-4-enyl-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine.
| Compound Name | 3-ethyl-1-methyl-1-pent-4-enyl-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 109498152 |
| Molecular Formula | C17H31N5 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | 3-ethyl-1-methyl-1-pent-4-enyl-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethyl]guanidine |
| SMILES | C=CCCCN(C)/C(=N/CCc1c(C)nn(C)c1C)NCC |
| InChI | InChI=1S/C17H31N5/c1-7-9-10-13-21(5)17(18-8-2)19-12-11-16-14(3)20-22(6)15(16)4/h7H,1,8-13H2,2-6H3,(H,18,19) |
| InChIKey | LYFNYJLKPKFQIS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 45.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|