C17H26FN3 — CID 109497096
3-ethyl-2-[2-(4-fluorophenyl)ethyl]-1-methyl-1-pent-4-enylguanidine (PubChem CID 109497096) has the molecular formula C17H26FN3 and a molecular weight of 291.41 g/mol. Its IUPAC name is 3-ethyl-2-[2-(4-fluorophenyl)ethyl]-1-methyl-1-pent-4-enylguanidine.
| Compound Name | 3-ethyl-2-[2-(4-fluorophenyl)ethyl]-1-methyl-1-pent-4-enylguanidine |
|---|---|
| PubChem CID | 109497096 |
| Molecular Formula | C17H26FN3 |
| Molecular Weight | 291.41 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | 3-ethyl-2-[2-(4-fluorophenyl)ethyl]-1-methyl-1-pent-4-enylguanidine |
| SMILES | C=CCCCN(C)/C(=N/CCc1ccc(F)cc1)NCC |
| InChI | InChI=1S/C17H26FN3/c1-4-6-7-14-21(3)17(19-5-2)20-13-12-15-8-10-16(18)11-9-15/h4,8-11H,1,5-7,12-14H2,2-3H3,(H,19,20) |
| InChIKey | QZXAAJVLYFUUBI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|