C18H30IN3O2S — CID 109499551
3-ethyl-1-methyl-2-[2-(4-methylsulfonylphenyl)ethyl]-1-pent-4-enylguanidine;hydroiodide (PubChem CID 109499551) has the molecular formula C18H30IN3O2S and a molecular weight of 479.43 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[2-(4-methylsulfonylphenyl)ethyl]-1-pent-4-enylguanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[2-(4-methylsulfonylphenyl)ethyl]-1-pent-4-enylguanidine;hydroiodide |
|---|---|
| PubChem CID | 109499551 |
| Molecular Formula | C18H30IN3O2S |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 3-ethyl-1-methyl-2-[2-(4-methylsulfonylphenyl)ethyl]-1-pent-4-enylguanidine;hydroiodide |
| SMILES | C=CCCCN(C)/C(=N/CCc1ccc(S(C)(=O)=O)cc1)NCC.I |
| InChI | InChI=1S/C18H29N3O2S.HI/c1-5-7-8-15-21(3)18(19-6-2)20-14-13-16-9-11-17(12-10-16)24(4,22)23;/h5,9-12H,1,6-8,13-15H2,2-4H3,(H,19,20);1H |
| InChIKey | OYYCGDCDVFSESJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|