C20H34IN3O3S — CID 109483100
3-ethyl-1-hept-6-enyl-1-methyl-2-[2-(4-methylsulfonylphenoxy)ethyl]guanidine;hydroiodide (PubChem CID 109483100) has the molecular formula C20H34IN3O3S and a molecular weight of 523.48 g/mol. Its IUPAC name is 3-ethyl-1-hept-6-enyl-1-methyl-2-[2-(4-methylsulfonylphenoxy)ethyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[2-(4-methylsulfonylphenoxy)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109483100 |
| Molecular Formula | C20H34IN3O3S |
| Molecular Weight | 523.48 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 3-ethyl-1-hept-6-enyl-1-methyl-2-[2-(4-methylsulfonylphenoxy)ethyl]guanidine;hydroiodide |
| SMILES | C=CCCCCCN(C)/C(=N/CCOc1ccc(S(C)(=O)=O)cc1)NCC.I |
| InChI | InChI=1S/C20H33N3O3S.HI/c1-5-7-8-9-10-16-23(3)20(21-6-2)22-15-17-26-18-11-13-19(14-12-18)27(4,24)25;/h5,11-14H,1,6-10,15-17H2,2-4H3,(H,21,22);1H |
| InChIKey | YWWRPTIZKCIKOT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|