C17H35N3O2S — CID 109483981
2-(2-tert-butylsulfonylethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine (PubChem CID 109483981) has the molecular formula C17H35N3O2S and a molecular weight of 345.55 g/mol. Its IUPAC name is 2-(2-tert-butylsulfonylethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine.
| Compound Name | 2-(2-tert-butylsulfonylethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine |
|---|---|
| PubChem CID | 109483981 |
| Molecular Formula | C17H35N3O2S |
| Molecular Weight | 345.55 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 2-(2-tert-butylsulfonylethyl)-3-ethyl-1-hept-6-enyl-1-methylguanidine |
| SMILES | C=CCCCCCN(C)/C(=N/CCS(=O)(=O)C(C)(C)C)NCC |
| InChI | InChI=1S/C17H35N3O2S/c1-7-9-10-11-12-14-20(6)16(18-8-2)19-13-15-23(21,22)17(3,4)5/h7H,1,8-15H2,2-6H3,(H,18,19) |
| InChIKey | LXXLIGOVJBPDFC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|